C12H18N2O2S — CID 156572232
7-propan-2-yl-1,2,3,4-tetrahydroisoquinoline-5-sulfonamide (PubChem CID 156572232) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is 7-propan-2-yl-1,2,3,4-tetrahydroisoquinoline-5-sulfonamide.
| Compound Name | 7-propan-2-yl-1,2,3,4-tetrahydroisoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 156572232 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 7-propan-2-yl-1,2,3,4-tetrahydroisoquinoline-5-sulfonamide |
| SMILES | CC(C)c1cc2c(c(S(N)(=O)=O)c1)CCNC2 |
| InChI | InChI=1S/C12H18N2O2S/c1-8(2)9-5-10-7-14-4-3-11(10)12(6-9)17(13,15)16/h5-6,8,14H,3-4,7H2,1-2H3,(H2,13,15,16) |
| InChIKey | NYLDOPIRQUUJAM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |