C12H21BrN2O2 — CID 156573453
2-[4-[(2-bromoacetyl)amino]cycloheptyl]-N-methylacetamide (PubChem CID 156573453) has the molecular formula C12H21BrN2O2 and a molecular weight of 305.22 g/mol. Its IUPAC name is 2-[4-[(2-bromoacetyl)amino]cycloheptyl]-N-methylacetamide.
| Compound Name | 2-[4-[(2-bromoacetyl)amino]cycloheptyl]-N-methylacetamide |
|---|---|
| PubChem CID | 156573453 |
| Molecular Formula | C12H21BrN2O2 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 2-[4-[(2-bromoacetyl)amino]cycloheptyl]-N-methylacetamide |
| SMILES | CNC(=O)CC1CCCC(NC(=O)CBr)CC1 |
| InChI | InChI=1S/C12H21BrN2O2/c1-14-11(16)7-9-3-2-4-10(6-5-9)15-12(17)8-13/h9-10H,2-8H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | DBVLOZXIRKANSP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|