About 4-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]methyl]naphthalene-1-carbonitrile
4-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]methyl]naphthalene-1-carbonitrile (PubChem CID 15657426) has the molecular formula C22H24N2
and a molecular weight of 316.45 g/mol. Its IUPAC name is 4-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]methyl]naphthalene-1-carbonitrile.
Molecular Properties
| Compound Name | 4-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]methyl]naphthalene-1-carbonitrile |
| PubChem CID | 15657426 |
| Molecular Formula | C22H24N2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 4-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]methyl]naphthalene-1-carbonitrile |
| SMILES | CN(C/C=C/C#CC(C)(C)C)Cc1ccc(C#N)c2ccccc12 |
| InChI | InChI=1S/C22H24N2/c1-22(2,3)14-8-5-9-15-24(4)17-19-13-12-18(16-23)20-10-6-7-11-21(19)20/h5-7,9-13H,15,17H2,1-4H3/b9-5+ |
| InChIKey | TUJXFWWIRCFHOS-WEVVVXLNSA-N |
| XLogP | 4.75 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]methyl]naphthalene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]methyl]naphthalene-1-carbonitrile?
The IUPAC name of 4-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]methyl]naphthalene-1-carbonitrile (CID 15657426) is 4-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]methyl]naphthalene-1-carbonitrile.
What is the SMILES notation for 4-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]methyl]naphthalene-1-carbonitrile?
The canonical SMILES for 4-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]methyl]naphthalene-1-carbonitrile is CN(C/C=C/C#CC(C)(C)C)Cc1ccc(C#N)c2ccccc12.
What is the InChIKey of 4-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]methyl]naphthalene-1-carbonitrile?
The InChIKey is TUJXFWWIRCFHOS-WEVVVXLNSA-N. The full InChI is InChI=1S/C22H24N2/c1-22(2,3)14-8-5-9-15-24(4)17-19-13-12-18(16-23)20-10-6-7-11-21(19)20/h5-7,9-13H,15,17H2,1-4H3/b9-5+.
What are the key properties of 4-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]methyl]naphthalene-1-carbonitrile?
4-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]methyl]naphthalene-1-carbonitrile has a molecular weight of 316.45 g/mol, XLogP of 4.75, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]methyl]naphthalene-1-carbonitrile is sourced from PubChem (CID 15657426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).