C20H22N4OS — CID 156574582
2-piperidin-1-yl-N-[(3-thiophen-2-yl-1H-pyrazol-5-yl)methyl]benzamide (PubChem CID 156574582) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 2-piperidin-1-yl-N-[(3-thiophen-2-yl-1H-pyrazol-5-yl)methyl]benzamide.
| Compound Name | 2-piperidin-1-yl-N-[(3-thiophen-2-yl-1H-pyrazol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 156574582 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-piperidin-1-yl-N-[(3-thiophen-2-yl-1H-pyrazol-5-yl)methyl]benzamide |
| SMILES | O=C(NCc1cc(-c2cccs2)n[nH]1)c1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C20H22N4OS/c25-20(16-7-2-3-8-18(16)24-10-4-1-5-11-24)21-14-15-13-17(23-22-15)19-9-6-12-26-19/h2-3,6-9,12-13H,1,4-5,10-11,14H2,(H,21,25)(H,22,23) |
| InChIKey | VOUDTEZBNRBSQS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |