C14H15BrN2O3 — CID 156575358
2-[(3-bromo-2-methylphenyl)methoxy]-4,6-dimethoxypyrimidine (PubChem CID 156575358) has the molecular formula C14H15BrN2O3 and a molecular weight of 339.19 g/mol. Its IUPAC name is 2-[(3-bromo-2-methylphenyl)methoxy]-4,6-dimethoxypyrimidine.
| Compound Name | 2-[(3-bromo-2-methylphenyl)methoxy]-4,6-dimethoxypyrimidine |
|---|---|
| PubChem CID | 156575358 |
| Molecular Formula | C14H15BrN2O3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 2-[(3-bromo-2-methylphenyl)methoxy]-4,6-dimethoxypyrimidine |
| SMILES | COc1cc(OC)nc(OCc2cccc(Br)c2C)n1 |
| InChI | InChI=1S/C14H15BrN2O3/c1-9-10(5-4-6-11(9)15)8-20-14-16-12(18-2)7-13(17-14)19-3/h4-7H,8H2,1-3H3 |
| InChIKey | OQIWIIVSVOFNAT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |