About 6-N,6-N-dimethyl-1-N-[4-(trifluoromethoxy)phenyl]isoquinoline-1,6-diamine
6-N,6-N-dimethyl-1-N-[4-(trifluoromethoxy)phenyl]isoquinoline-1,6-diamine (PubChem CID 156575828) has the molecular formula C18H16F3N3O
and a molecular weight of 347.34 g/mol. Its IUPAC name is 6-N,6-N-dimethyl-1-N-[4-(trifluoromethoxy)phenyl]isoquinoline-1,6-diamine.
Molecular Properties
| Compound Name | 6-N,6-N-dimethyl-1-N-[4-(trifluoromethoxy)phenyl]isoquinoline-1,6-diamine |
| PubChem CID | 156575828 |
| Molecular Formula | C18H16F3N3O |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 6-N,6-N-dimethyl-1-N-[4-(trifluoromethoxy)phenyl]isoquinoline-1,6-diamine |
| SMILES | CN(C)c1ccc2c(Nc3ccc(OC(F)(F)F)cc3)nccc2c1 |
| InChI | InChI=1S/C18H16F3N3O/c1-24(2)14-5-8-16-12(11-14)9-10-22-17(16)23-13-3-6-15(7-4-13)25-18(19,20)21/h3-11H,1-2H3,(H,22,23) |
| InChIKey | PLBNDDSJBMGJIP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-N,6-N-dimethyl-1-N-[4-(trifluoromethoxy)phenyl]isoquinoline-1,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N,6-N-dimethyl-1-N-[4-(trifluoromethoxy)phenyl]isoquinoline-1,6-diamine?
The IUPAC name of 6-N,6-N-dimethyl-1-N-[4-(trifluoromethoxy)phenyl]isoquinoline-1,6-diamine (CID 156575828) is 6-N,6-N-dimethyl-1-N-[4-(trifluoromethoxy)phenyl]isoquinoline-1,6-diamine.
What is the SMILES notation for 6-N,6-N-dimethyl-1-N-[4-(trifluoromethoxy)phenyl]isoquinoline-1,6-diamine?
The canonical SMILES for 6-N,6-N-dimethyl-1-N-[4-(trifluoromethoxy)phenyl]isoquinoline-1,6-diamine is CN(C)c1ccc2c(Nc3ccc(OC(F)(F)F)cc3)nccc2c1.
What is the InChIKey of 6-N,6-N-dimethyl-1-N-[4-(trifluoromethoxy)phenyl]isoquinoline-1,6-diamine?
The InChIKey is PLBNDDSJBMGJIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F3N3O/c1-24(2)14-5-8-16-12(11-14)9-10-22-17(16)23-13-3-6-15(7-4-13)25-18(19,20)21/h3-11H,1-2H3,(H,22,23).
What are the key properties of 6-N,6-N-dimethyl-1-N-[4-(trifluoromethoxy)phenyl]isoquinoline-1,6-diamine?
6-N,6-N-dimethyl-1-N-[4-(trifluoromethoxy)phenyl]isoquinoline-1,6-diamine has a molecular weight of 347.34 g/mol, XLogP of 4.94, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N,6-N-dimethyl-1-N-[4-(trifluoromethoxy)phenyl]isoquinoline-1,6-diamine is sourced from PubChem (CID 156575828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).