About (3Z)-5-(methylamino)hepta-1,3-diene-2-sulfinate
(3Z)-5-(methylamino)hepta-1,3-diene-2-sulfinate (PubChem CID 156575899) has the molecular formula C8H14NO2S-
and a molecular weight of 188.27 g/mol. Its IUPAC name is (3Z)-5-(methylamino)hepta-1,3-diene-2-sulfinate.
Molecular Properties
| Compound Name | (3Z)-5-(methylamino)hepta-1,3-diene-2-sulfinate |
| PubChem CID | 156575899 |
| Molecular Formula | C8H14NO2S- |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | (3Z)-5-(methylamino)hepta-1,3-diene-2-sulfinate |
| SMILES | C=C(/C=C\C(CC)NC)S(=O)[O-] |
| InChI | InChI=1S/C8H15NO2S/c1-4-8(9-3)6-5-7(2)12(10)11/h5-6,8-9H,2,4H2,1,3H3,(H,10,11)/p-1/b6-5- |
| InChIKey | KMLTXHIXSLGXGT-WAYWQWQTSA-M |
| XLogP | 0.93 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-5-(methylamino)hepta-1,3-diene-2-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-5-(methylamino)hepta-1,3-diene-2-sulfinate?
The IUPAC name of (3Z)-5-(methylamino)hepta-1,3-diene-2-sulfinate (CID 156575899) is (3Z)-5-(methylamino)hepta-1,3-diene-2-sulfinate.
What is the SMILES notation for (3Z)-5-(methylamino)hepta-1,3-diene-2-sulfinate?
The canonical SMILES for (3Z)-5-(methylamino)hepta-1,3-diene-2-sulfinate is C=C(/C=C\C(CC)NC)S(=O)[O-].
What is the InChIKey of (3Z)-5-(methylamino)hepta-1,3-diene-2-sulfinate?
The InChIKey is KMLTXHIXSLGXGT-WAYWQWQTSA-M. The full InChI is InChI=1S/C8H15NO2S/c1-4-8(9-3)6-5-7(2)12(10)11/h5-6,8-9H,2,4H2,1,3H3,(H,10,11)/p-1/b6-5-.
What are the key properties of (3Z)-5-(methylamino)hepta-1,3-diene-2-sulfinate?
(3Z)-5-(methylamino)hepta-1,3-diene-2-sulfinate has a molecular weight of 188.27 g/mol, XLogP of 0.93, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-5-(methylamino)hepta-1,3-diene-2-sulfinate is sourced from PubChem (CID 156575899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).