C23H28N4O — CID 156575945
4-[(1S)-1-aminoethyl]-1-[[(2-phenyl-1H-pyrrolo[2,3-b]pyridin-4-yl)amino]methyl]cyclohexane-1-carbaldehyde (PubChem CID 156575945) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is 4-[(1S)-1-aminoethyl]-1-[[(2-phenyl-1H-pyrrolo[2,3-b]pyridin-4-yl)amino]methyl]cyclohexane-1-carbaldehyde.
| Compound Name | 4-[(1S)-1-aminoethyl]-1-[[(2-phenyl-1H-pyrrolo[2,3-b]pyridin-4-yl)amino]methyl]cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 156575945 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 4-[(1S)-1-aminoethyl]-1-[[(2-phenyl-1H-pyrrolo[2,3-b]pyridin-4-yl)amino]methyl]cyclohexane-1-carbaldehyde |
| SMILES | C[C@H](N)C1CCC(C=O)(CNc2ccnc3[nH]c(-c4ccccc4)cc23)CC1 |
| InChI | InChI=1S/C23H28N4O/c1-16(24)17-7-10-23(15-28,11-8-17)14-26-20-9-12-25-22-19(20)13-21(27-22)18-5-3-2-4-6-18/h2-6,9,12-13,15-17H,7-8,10-11,14,24H2,1H3,(H2,25,26,27)/t16-,17?,23?/m0/s1 |
| InChIKey | KRBFQSGHELSTIN-RJNZEALMSA-N |
| XLogP | 4.36 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|