About 3-fluoro-4-[(3-methyl-1,1-dioxothieno[2,3-g]quinolin-8-yl)amino]phenol
3-fluoro-4-[(3-methyl-1,1-dioxothieno[2,3-g]quinolin-8-yl)amino]phenol (PubChem CID 156576041) has the molecular formula C18H13FN2O3S
and a molecular weight of 356.38 g/mol. Its IUPAC name is 3-fluoro-4-[(3-methyl-1,1-dioxothieno[2,3-g]quinolin-8-yl)amino]phenol.
Molecular Properties
| Compound Name | 3-fluoro-4-[(3-methyl-1,1-dioxothieno[2,3-g]quinolin-8-yl)amino]phenol |
| PubChem CID | 156576041 |
| Molecular Formula | C18H13FN2O3S |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 3-fluoro-4-[(3-methyl-1,1-dioxothieno[2,3-g]quinolin-8-yl)amino]phenol |
| SMILES | CC1=CS(=O)(=O)c2cc3c(Nc4ccc(O)cc4F)ccnc3cc21 |
| InChI | InChI=1S/C18H13FN2O3S/c1-10-9-25(23,24)18-8-13-15(4-5-20-17(13)7-12(10)18)21-16-3-2-11(22)6-14(16)19/h2-9,22H,1H3,(H,20,21) |
| InChIKey | XLJPCAMJINUBMS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-4-[(3-methyl-1,1-dioxothieno[2,3-g]quinolin-8-yl)amino]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-[(3-methyl-1,1-dioxothieno[2,3-g]quinolin-8-yl)amino]phenol?
The IUPAC name of 3-fluoro-4-[(3-methyl-1,1-dioxothieno[2,3-g]quinolin-8-yl)amino]phenol (CID 156576041) is 3-fluoro-4-[(3-methyl-1,1-dioxothieno[2,3-g]quinolin-8-yl)amino]phenol.
What is the SMILES notation for 3-fluoro-4-[(3-methyl-1,1-dioxothieno[2,3-g]quinolin-8-yl)amino]phenol?
The canonical SMILES for 3-fluoro-4-[(3-methyl-1,1-dioxothieno[2,3-g]quinolin-8-yl)amino]phenol is CC1=CS(=O)(=O)c2cc3c(Nc4ccc(O)cc4F)ccnc3cc21.
What is the InChIKey of 3-fluoro-4-[(3-methyl-1,1-dioxothieno[2,3-g]quinolin-8-yl)amino]phenol?
The InChIKey is XLJPCAMJINUBMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13FN2O3S/c1-10-9-25(23,24)18-8-13-15(4-5-20-17(13)7-12(10)18)21-16-3-2-11(22)6-14(16)19/h2-9,22H,1H3,(H,20,21).
What are the key properties of 3-fluoro-4-[(3-methyl-1,1-dioxothieno[2,3-g]quinolin-8-yl)amino]phenol?
3-fluoro-4-[(3-methyl-1,1-dioxothieno[2,3-g]quinolin-8-yl)amino]phenol has a molecular weight of 356.38 g/mol, XLogP of 3.97, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-[(3-methyl-1,1-dioxothieno[2,3-g]quinolin-8-yl)amino]phenol is sourced from PubChem (CID 156576041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).