About (5Z,7Z)-4-methyl-9,10-dihydrobenzo[8]annulen-1-amine
(5Z,7Z)-4-methyl-9,10-dihydrobenzo[8]annulen-1-amine (PubChem CID 156576675) has the molecular formula C13H15N
and a molecular weight of 185.27 g/mol. Its IUPAC name is (5Z,7Z)-4-methyl-9,10-dihydrobenzo[8]annulen-1-amine.
Molecular Properties
| Compound Name | (5Z,7Z)-4-methyl-9,10-dihydrobenzo[8]annulen-1-amine |
| PubChem CID | 156576675 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (5Z,7Z)-4-methyl-9,10-dihydrobenzo[8]annulen-1-amine |
| SMILES | Cc1ccc(N)c2c1/C=C\C=C/CC2 |
| InChI | InChI=1S/C13H15N/c1-10-8-9-13(14)12-7-5-3-2-4-6-11(10)12/h2-4,6,8-9H,5,7,14H2,1H3/b3-2-,6-4- |
| InChIKey | PLELPOPIICGLLU-BXAWZMCCSA-N |
| XLogP | 3.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (5Z,7Z)-4-methyl-9,10-dihydrobenzo[8]annulen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,7Z)-4-methyl-9,10-dihydrobenzo[8]annulen-1-amine?
The IUPAC name of (5Z,7Z)-4-methyl-9,10-dihydrobenzo[8]annulen-1-amine (CID 156576675) is (5Z,7Z)-4-methyl-9,10-dihydrobenzo[8]annulen-1-amine.
What is the SMILES notation for (5Z,7Z)-4-methyl-9,10-dihydrobenzo[8]annulen-1-amine?
The canonical SMILES for (5Z,7Z)-4-methyl-9,10-dihydrobenzo[8]annulen-1-amine is Cc1ccc(N)c2c1/C=C\C=C/CC2.
What is the InChIKey of (5Z,7Z)-4-methyl-9,10-dihydrobenzo[8]annulen-1-amine?
The InChIKey is PLELPOPIICGLLU-BXAWZMCCSA-N. The full InChI is InChI=1S/C13H15N/c1-10-8-9-13(14)12-7-5-3-2-4-6-11(10)12/h2-4,6,8-9H,5,7,14H2,1H3/b3-2-,6-4-.
What are the key properties of (5Z,7Z)-4-methyl-9,10-dihydrobenzo[8]annulen-1-amine?
(5Z,7Z)-4-methyl-9,10-dihydrobenzo[8]annulen-1-amine has a molecular weight of 185.27 g/mol, XLogP of 3.09, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,7Z)-4-methyl-9,10-dihydrobenzo[8]annulen-1-amine is sourced from PubChem (CID 156576675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).