C19H17BrF3N5O — CID 156576771
1-(6-bromo-5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-3-[6-(4,4-difluorocyclohexyl)-3-pyridinyl]urea (PubChem CID 156576771) has the molecular formula C19H17BrF3N5O and a molecular weight of 468.28 g/mol. Its IUPAC name is 1-(6-bromo-5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-3-[6-(4,4-difluorocyclohexyl)-3-pyridinyl]urea.
| Compound Name | 1-(6-bromo-5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-3-[6-(4,4-difluorocyclohexyl)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 156576771 |
| Molecular Formula | C19H17BrF3N5O |
| Molecular Weight | 468.28 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | 1-(6-bromo-5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-3-[6-(4,4-difluorocyclohexyl)-3-pyridinyl]urea |
| SMILES | O=C(Nc1ccc(C2CCC(F)(F)CC2)nc1)Nc1c[nH]c2nc(Br)c(F)cc12 |
| InChI | InChI=1S/C19H17BrF3N5O/c20-16-13(21)7-12-15(9-25-17(12)28-16)27-18(29)26-11-1-2-14(24-8-11)10-3-5-19(22,23)6-4-10/h1-2,7-10H,3-6H2,(H,25,28)(H2,26,27,29) |
| InChIKey | REEUABQOHLLYNG-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.28 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|