C14H19N — CID 15657682
2,3,4,9,10,10a-hexahydro-1H-phenanthren-4a-amine (PubChem CID 15657682) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 2,3,4,9,10,10a-hexahydro-1H-phenanthren-4a-amine.
| Compound Name | 2,3,4,9,10,10a-hexahydro-1H-phenanthren-4a-amine |
|---|---|
| PubChem CID | 15657682 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2,3,4,9,10,10a-hexahydro-1H-phenanthren-4a-amine |
| SMILES | NC12CCCCC1CCc1ccccc12 |
| InChI | InChI=1S/C14H19N/c15-14-10-4-3-6-12(14)9-8-11-5-1-2-7-13(11)14/h1-2,5,7,12H,3-4,6,8-10,15H2 |
| InChIKey | OTEQTANHGJAIKB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |