About N-[(1Z)-buta-1,3-dienyl]-3-methylidene-1H-pyrrol-2-imine
N-[(1Z)-buta-1,3-dienyl]-3-methylidene-1H-pyrrol-2-imine (PubChem CID 156576912) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is N-[(1Z)-buta-1,3-dienyl]-3-methylidene-1H-pyrrol-2-imine.
Molecular Properties
| Compound Name | N-[(1Z)-buta-1,3-dienyl]-3-methylidene-1H-pyrrol-2-imine |
| PubChem CID | 156576912 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | N-[(1Z)-buta-1,3-dienyl]-3-methylidene-1H-pyrrol-2-imine |
| SMILES | C=C/C=C\N=C1/NC=CC1=C |
| InChI | InChI=1S/C9H10N2/c1-3-4-6-10-9-8(2)5-7-11-9/h3-7H,1-2H2,(H,10,11)/b6-4- |
| InChIKey | IYNZVBFCRFLKDW-XQRVVYSFSA-N |
| XLogP | 1.76 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1Z)-buta-1,3-dienyl]-3-methylidene-1H-pyrrol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1Z)-buta-1,3-dienyl]-3-methylidene-1H-pyrrol-2-imine?
The IUPAC name of N-[(1Z)-buta-1,3-dienyl]-3-methylidene-1H-pyrrol-2-imine (CID 156576912) is N-[(1Z)-buta-1,3-dienyl]-3-methylidene-1H-pyrrol-2-imine.
What is the SMILES notation for N-[(1Z)-buta-1,3-dienyl]-3-methylidene-1H-pyrrol-2-imine?
The canonical SMILES for N-[(1Z)-buta-1,3-dienyl]-3-methylidene-1H-pyrrol-2-imine is C=C/C=C\N=C1/NC=CC1=C.
What is the InChIKey of N-[(1Z)-buta-1,3-dienyl]-3-methylidene-1H-pyrrol-2-imine?
The InChIKey is IYNZVBFCRFLKDW-XQRVVYSFSA-N. The full InChI is InChI=1S/C9H10N2/c1-3-4-6-10-9-8(2)5-7-11-9/h3-7H,1-2H2,(H,10,11)/b6-4-.
What are the key properties of N-[(1Z)-buta-1,3-dienyl]-3-methylidene-1H-pyrrol-2-imine?
N-[(1Z)-buta-1,3-dienyl]-3-methylidene-1H-pyrrol-2-imine has a molecular weight of 146.19 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z)-buta-1,3-dienyl]-3-methylidene-1H-pyrrol-2-imine is sourced from PubChem (CID 156576912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).