C26H17Br2N3 — CID 156577333
2,4-dibromo-9-(9,9-dimethylfluoren-2-yl)pyrido[3,2-h]quinazoline (PubChem CID 156577333) has the molecular formula C26H17Br2N3 and a molecular weight of 531.25 g/mol. Its IUPAC name is 2,4-dibromo-9-(9,9-dimethylfluoren-2-yl)pyrido[3,2-h]quinazoline.
| Compound Name | 2,4-dibromo-9-(9,9-dimethylfluoren-2-yl)pyrido[3,2-h]quinazoline |
|---|---|
| PubChem CID | 156577333 |
| Molecular Formula | C26H17Br2N3 |
| Molecular Weight | 531.25 g/mol |
| Exact Mass | 528.98 |
| IUPAC Name | 2,4-dibromo-9-(9,9-dimethylfluoren-2-yl)pyrido[3,2-h]quinazoline |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc4ccc5c(Br)nc(Br)nc5c4n3)cc21 |
| InChI | InChI=1S/C26H17Br2N3/c1-26(2)19-6-4-3-5-16(19)17-10-8-15(13-20(17)26)21-12-9-14-7-11-18-23(22(14)29-21)30-25(28)31-24(18)27/h3-13H,1-2H3 |
| InChIKey | JJQCYESAGCHQNM-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.25 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|