About 5-[(1S)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-iodo-2H-indazole
5-[(1S)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-iodo-2H-indazole (PubChem CID 156577917) has the molecular formula C14H10Cl2IN3O
and a molecular weight of 434.06 g/mol. Its IUPAC name is 5-[(1S)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-iodo-2H-indazole.
Molecular Properties
| Compound Name | 5-[(1S)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-iodo-2H-indazole |
| PubChem CID | 156577917 |
| Molecular Formula | C14H10Cl2IN3O |
| Molecular Weight | 434.06 g/mol |
| Exact Mass | 432.92 |
| IUPAC Name | 5-[(1S)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-iodo-2H-indazole |
| SMILES | C[C@H](Oc1ccc2n[nH]c(I)c2c1)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C14H10Cl2IN3O/c1-7(13-10(15)5-18-6-11(13)16)21-8-2-3-12-9(4-8)14(17)20-19-12/h2-7H,1H3,(H,19,20)/t7-/m0/s1 |
| InChIKey | MASKCABUWSYOLR-ZETCQYMHSA-N |
| XLogP | 5.01 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.06 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1S)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-iodo-2H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1S)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-iodo-2H-indazole?
The IUPAC name of 5-[(1S)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-iodo-2H-indazole (CID 156577917) is 5-[(1S)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-iodo-2H-indazole.
What is the SMILES notation for 5-[(1S)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-iodo-2H-indazole?
The canonical SMILES for 5-[(1S)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-iodo-2H-indazole is C[C@H](Oc1ccc2n[nH]c(I)c2c1)c1c(Cl)cncc1Cl.
What is the InChIKey of 5-[(1S)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-iodo-2H-indazole?
The InChIKey is MASKCABUWSYOLR-ZETCQYMHSA-N. The full InChI is InChI=1S/C14H10Cl2IN3O/c1-7(13-10(15)5-18-6-11(13)16)21-8-2-3-12-9(4-8)14(17)20-19-12/h2-7H,1H3,(H,19,20)/t7-/m0/s1.
What are the key properties of 5-[(1S)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-iodo-2H-indazole?
5-[(1S)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-iodo-2H-indazole has a molecular weight of 434.06 g/mol, XLogP of 5.01, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1S)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-iodo-2H-indazole is sourced from PubChem (CID 156577917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).