C16H12FN5O3 — CID 156578941
methyl 3-fluoro-2-[(6-imidazol-1-ylpyridazine-3-carbonyl)amino]benzoate (PubChem CID 156578941) has the molecular formula C16H12FN5O3 and a molecular weight of 341.30 g/mol. Its IUPAC name is methyl 3-fluoro-2-[(6-imidazol-1-ylpyridazine-3-carbonyl)amino]benzoate.
| Compound Name | methyl 3-fluoro-2-[(6-imidazol-1-ylpyridazine-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 156578941 |
| Molecular Formula | C16H12FN5O3 |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | methyl 3-fluoro-2-[(6-imidazol-1-ylpyridazine-3-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1cccc(F)c1NC(=O)c1ccc(-n2ccnc2)nn1 |
| InChI | InChI=1S/C16H12FN5O3/c1-25-16(24)10-3-2-4-11(17)14(10)19-15(23)12-5-6-13(21-20-12)22-8-7-18-9-22/h2-9H,1H3,(H,19,23) |
| InChIKey | GNWXJZZYLGCKJW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |