C15H25F6NO — CID 156578956
1,1,1,3,3,3-hexafluoro-2-[(4-hexyl-2-methylpyrrolidin-1-yl)methyl]propan-2-ol (PubChem CID 156578956) has the molecular formula C15H25F6NO and a molecular weight of 349.36 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[(4-hexyl-2-methylpyrrolidin-1-yl)methyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[(4-hexyl-2-methylpyrrolidin-1-yl)methyl]propan-2-ol |
|---|---|
| PubChem CID | 156578956 |
| Molecular Formula | C15H25F6NO |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[(4-hexyl-2-methylpyrrolidin-1-yl)methyl]propan-2-ol |
| SMILES | CCCCCCC1CC(C)N(CC(O)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C15H25F6NO/c1-3-4-5-6-7-12-8-11(2)22(9-12)10-13(23,14(16,17)18)15(19,20)21/h11-12,23H,3-10H2,1-2H3 |
| InChIKey | XBUSSLONEQRSGW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|