C13H13FS — CID 156578989
2-fluoro-6-methyl-3,4,5a,9a-tetrahydrodibenzothiophene (PubChem CID 156578989) has the molecular formula C13H13FS and a molecular weight of 220.31 g/mol. Its IUPAC name is 2-fluoro-6-methyl-3,4,5a,9a-tetrahydrodibenzothiophene.
| Compound Name | 2-fluoro-6-methyl-3,4,5a,9a-tetrahydrodibenzothiophene |
|---|---|
| PubChem CID | 156578989 |
| Molecular Formula | C13H13FS |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-fluoro-6-methyl-3,4,5a,9a-tetrahydrodibenzothiophene |
| SMILES | CC1=CC=CC2C3=C(CCC(F)=C3)SC12 |
| InChI | InChI=1S/C13H13FS/c1-8-3-2-4-10-11-7-9(14)5-6-12(11)15-13(8)10/h2-4,7,10,13H,5-6H2,1H3 |
| InChIKey | HLMNOGWBWHGAFW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |