About 2-methoxypropanimidamide
2-methoxypropanimidamide (PubChem CID 15657909) has the molecular formula C4H10N2O
and a molecular weight of 102.14 g/mol. Its IUPAC name is 2-methoxypropanimidamide.
Molecular Properties
| Compound Name | 2-methoxypropanimidamide |
| PubChem CID | 15657909 |
| Molecular Formula | C4H10N2O |
| Molecular Weight | 102.14 g/mol |
| Exact Mass | 102.08 |
| IUPAC Name | 2-methoxypropanimidamide |
| SMILES | [H]/N=C(\N)C(C)OC |
| InChI | InChI=1S/C4H10N2O/c1-3(7-2)4(5)6/h3H,1-2H3,(H3,5,6) |
| InChIKey | ITEDVEJYKUPNNY-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.14 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxypropanimidamide?
The IUPAC name of 2-methoxypropanimidamide (CID 15657909) is 2-methoxypropanimidamide.
What is the SMILES notation for 2-methoxypropanimidamide?
The canonical SMILES for 2-methoxypropanimidamide is [H]/N=C(\N)C(C)OC.
What is the InChIKey of 2-methoxypropanimidamide?
The InChIKey is ITEDVEJYKUPNNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O/c1-3(7-2)4(5)6/h3H,1-2H3,(H3,5,6).
What are the key properties of 2-methoxypropanimidamide?
2-methoxypropanimidamide has a molecular weight of 102.14 g/mol, XLogP of -0.04, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxypropanimidamide is sourced from PubChem (CID 15657909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).