C29H49N3O3 — CID 156579184
[(3S,5R,6R,8S,9S,10R,13R,14S,17R)-5-azido-6-hydroxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 156579184) has the molecular formula C29H49N3O3 and a molecular weight of 487.73 g/mol. Its IUPAC name is [(3S,5R,6R,8S,9S,10R,13R,14S,17R)-5-azido-6-hydroxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,5R,6R,8S,9S,10R,13R,14S,17R)-5-azido-6-hydroxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 156579184 |
| Molecular Formula | C29H49N3O3 |
| Molecular Weight | 487.73 g/mol |
| Exact Mass | 487.38 |
| IUPAC Name | [(3S,5R,6R,8S,9S,10R,13R,14S,17R)-5-azido-6-hydroxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C)[C@H]3CC[C@]4(C)[C@@H](C(C)CCCC(C)C)CC[C@H]4[C@@H]3C[C@@H](O)[C@@]2(N=[N+]=[N-])C1 |
| InChI | InChI=1S/C29H49N3O3/c1-18(2)8-7-9-19(3)23-10-11-24-22-16-26(34)29(31-32-30)17-21(35-20(4)33)12-15-28(29,6)25(22)13-14-27(23,24)5/h18-19,21-26,34H,7-17H2,1-6H3/t19?,21-,22-,23+,24-,25-,26+,27+,28+,29-/m0/s1 |
| InChIKey | QLDXCOREVODNPZ-PATWQHOFSA-N |
| XLogP | 7.44 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.73 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|