C11H11NS — CID 156579592
1,2,3a,4-tetrahydrothieno[2,3-c]isoquinoline (PubChem CID 156579592) has the molecular formula C11H11NS and a molecular weight of 189.28 g/mol. Its IUPAC name is 1,2,3a,4-tetrahydrothieno[2,3-c]isoquinoline.
| Compound Name | 1,2,3a,4-tetrahydrothieno[2,3-c]isoquinoline |
|---|---|
| PubChem CID | 156579592 |
| Molecular Formula | C11H11NS |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 1,2,3a,4-tetrahydrothieno[2,3-c]isoquinoline |
| SMILES | C1=c2ccccc2=C2CCSC2N1 |
| InChI | InChI=1S/C11H11NS/c1-2-4-9-8(3-1)7-12-11-10(9)5-6-13-11/h1-4,7,11-12H,5-6H2 |
| InChIKey | ARRXMIIFWKKINO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |