About 2-sulfanylidene-1,3-diazinane-4,6-dione;hydrochloride
2-sulfanylidene-1,3-diazinane-4,6-dione;hydrochloride (PubChem CID 156579793) has the molecular formula C4H5ClN2O2S
and a molecular weight of 180.62 g/mol. Its IUPAC name is 2-sulfanylidene-1,3-diazinane-4,6-dione;hydrochloride.
Molecular Properties
| Compound Name | 2-sulfanylidene-1,3-diazinane-4,6-dione;hydrochloride |
| PubChem CID | 156579793 |
| Molecular Formula | C4H5ClN2O2S |
| Molecular Weight | 180.62 g/mol |
| Exact Mass | 179.98 |
| IUPAC Name | 2-sulfanylidene-1,3-diazinane-4,6-dione;hydrochloride |
| SMILES | Cl.O=C1CC(=O)NC(=S)N1 |
| InChI | InChI=1S/C4H4N2O2S.ClH/c7-2-1-3(8)6-4(9)5-2;/h1H2,(H2,5,6,7,8,9);1H |
| InChIKey | AVLRQXZWSDQXHE-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.62 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylidene-1,3-diazinane-4,6-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylidene-1,3-diazinane-4,6-dione;hydrochloride?
The IUPAC name of 2-sulfanylidene-1,3-diazinane-4,6-dione;hydrochloride (CID 156579793) is 2-sulfanylidene-1,3-diazinane-4,6-dione;hydrochloride.
What is the SMILES notation for 2-sulfanylidene-1,3-diazinane-4,6-dione;hydrochloride?
The canonical SMILES for 2-sulfanylidene-1,3-diazinane-4,6-dione;hydrochloride is Cl.O=C1CC(=O)NC(=S)N1.
What is the InChIKey of 2-sulfanylidene-1,3-diazinane-4,6-dione;hydrochloride?
The InChIKey is AVLRQXZWSDQXHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2S.ClH/c7-2-1-3(8)6-4(9)5-2;/h1H2,(H2,5,6,7,8,9);1H.
What are the key properties of 2-sulfanylidene-1,3-diazinane-4,6-dione;hydrochloride?
2-sulfanylidene-1,3-diazinane-4,6-dione;hydrochloride has a molecular weight of 180.62 g/mol, XLogP of -0.67, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylidene-1,3-diazinane-4,6-dione;hydrochloride is sourced from PubChem (CID 156579793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).