About cadmium;bis(1H-pyrazole-5-carboxylic acid)
cadmium;bis(1H-pyrazole-5-carboxylic acid) (PubChem CID 156579853) has the molecular formula C8H8CdN4O4
and a molecular weight of 336.59 g/mol. Its IUPAC name is cadmium;bis(1H-pyrazole-5-carboxylic acid).
Molecular Properties
| Compound Name | cadmium;bis(1H-pyrazole-5-carboxylic acid) |
| PubChem CID | 156579853 |
| Molecular Formula | C8H8CdN4O4 |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 337.96 |
| IUPAC Name | cadmium;bis(1H-pyrazole-5-carboxylic acid) |
| SMILES | O=C(O)c1ccn[nH]1.O=C(O)c1ccn[nH]1.[Cd] |
| InChI | InChI=1S/2C4H4N2O2.Cd/c2*7-4(8)3-1-2-5-6-3;/h2*1-2H,(H,5,6)(H,7,8); |
| InChIKey | KYZWJTAFBYOAHF-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cadmium;bis(1H-pyrazole-5-carboxylic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium;bis(1H-pyrazole-5-carboxylic acid)?
The IUPAC name of cadmium;bis(1H-pyrazole-5-carboxylic acid) (CID 156579853) is cadmium;bis(1H-pyrazole-5-carboxylic acid).
What is the SMILES notation for cadmium;bis(1H-pyrazole-5-carboxylic acid)?
The canonical SMILES for cadmium;bis(1H-pyrazole-5-carboxylic acid) is O=C(O)c1ccn[nH]1.O=C(O)c1ccn[nH]1.[Cd].
What is the InChIKey of cadmium;bis(1H-pyrazole-5-carboxylic acid)?
The InChIKey is KYZWJTAFBYOAHF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H4N2O2.Cd/c2*7-4(8)3-1-2-5-6-3;/h2*1-2H,(H,5,6)(H,7,8);.
What are the key properties of cadmium;bis(1H-pyrazole-5-carboxylic acid)?
cadmium;bis(1H-pyrazole-5-carboxylic acid) has a molecular weight of 336.59 g/mol, XLogP of 0.21, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium;bis(1H-pyrazole-5-carboxylic acid) is sourced from PubChem (CID 156579853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).