C20H16ClNO7 — CID 156580047
2-[(3E)-3-[(4-chlorophenyl)-hydroxymethylidene]-2-(4-hydroxy-3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]acetic acid (PubChem CID 156580047) has the molecular formula C20H16ClNO7 and a molecular weight of 417.80 g/mol. Its IUPAC name is 2-[(3E)-3-[(4-chlorophenyl)-hydroxymethylidene]-2-(4-hydroxy-3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[(3E)-3-[(4-chlorophenyl)-hydroxymethylidene]-2-(4-hydroxy-3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 156580047 |
| Molecular Formula | C20H16ClNO7 |
| Molecular Weight | 417.80 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 2-[(3E)-3-[(4-chlorophenyl)-hydroxymethylidene]-2-(4-hydroxy-3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]acetic acid |
| SMILES | COc1cc(C2/C(=C(\O)c3ccc(Cl)cc3)C(=O)C(=O)N2CC(=O)O)ccc1O |
| InChI | InChI=1S/C20H16ClNO7/c1-29-14-8-11(4-7-13(14)23)17-16(18(26)10-2-5-12(21)6-3-10)19(27)20(28)22(17)9-15(24)25/h2-8,17,23,26H,9H2,1H3,(H,24,25)/b18-16+ |
| InChIKey | WTOCEBAXTXYRQH-FBMGVBCBSA-N |
| XLogP | 2.56 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.80 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|