About 2-[5-(2,5-dimethylphenoxy)-3-methyl-1-phenylpyrazol-4-yl]-1H-benzimidazole
2-[5-(2,5-dimethylphenoxy)-3-methyl-1-phenylpyrazol-4-yl]-1H-benzimidazole (PubChem CID 156580073) has the molecular formula C25H22N4O
and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-[5-(2,5-dimethylphenoxy)-3-methyl-1-phenylpyrazol-4-yl]-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-[5-(2,5-dimethylphenoxy)-3-methyl-1-phenylpyrazol-4-yl]-1H-benzimidazole |
| PubChem CID | 156580073 |
| Molecular Formula | C25H22N4O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 2-[5-(2,5-dimethylphenoxy)-3-methyl-1-phenylpyrazol-4-yl]-1H-benzimidazole |
| SMILES | Cc1ccc(C)c(Oc2c(-c3nc4ccccc4[nH]3)c(C)nn2-c2ccccc2)c1 |
| InChI | InChI=1S/C25H22N4O/c1-16-13-14-17(2)22(15-16)30-25-23(24-26-20-11-7-8-12-21(20)27-24)18(3)28-29(25)19-9-5-4-6-10-19/h4-15H,1-3H3,(H,26,27) |
| InChIKey | UFSYMVBISUMWKC-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-(2,5-dimethylphenoxy)-3-methyl-1-phenylpyrazol-4-yl]-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2,5-dimethylphenoxy)-3-methyl-1-phenylpyrazol-4-yl]-1H-benzimidazole?
The IUPAC name of 2-[5-(2,5-dimethylphenoxy)-3-methyl-1-phenylpyrazol-4-yl]-1H-benzimidazole (CID 156580073) is 2-[5-(2,5-dimethylphenoxy)-3-methyl-1-phenylpyrazol-4-yl]-1H-benzimidazole.
What is the SMILES notation for 2-[5-(2,5-dimethylphenoxy)-3-methyl-1-phenylpyrazol-4-yl]-1H-benzimidazole?
The canonical SMILES for 2-[5-(2,5-dimethylphenoxy)-3-methyl-1-phenylpyrazol-4-yl]-1H-benzimidazole is Cc1ccc(C)c(Oc2c(-c3nc4ccccc4[nH]3)c(C)nn2-c2ccccc2)c1.
What is the InChIKey of 2-[5-(2,5-dimethylphenoxy)-3-methyl-1-phenylpyrazol-4-yl]-1H-benzimidazole?
The InChIKey is UFSYMVBISUMWKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22N4O/c1-16-13-14-17(2)22(15-16)30-25-23(24-26-20-11-7-8-12-21(20)27-24)18(3)28-29(25)19-9-5-4-6-10-19/h4-15H,1-3H3,(H,26,27).
What are the key properties of 2-[5-(2,5-dimethylphenoxy)-3-methyl-1-phenylpyrazol-4-yl]-1H-benzimidazole?
2-[5-(2,5-dimethylphenoxy)-3-methyl-1-phenylpyrazol-4-yl]-1H-benzimidazole has a molecular weight of 394.48 g/mol, XLogP of 6.13, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2,5-dimethylphenoxy)-3-methyl-1-phenylpyrazol-4-yl]-1H-benzimidazole is sourced from PubChem (CID 156580073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).