C48H25F12N — CID 156580224
N,N-bis[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]perylen-3-amine (PubChem CID 156580224) has the molecular formula C48H25F12N and a molecular weight of 843.71 g/mol. Its IUPAC name is N,N-bis[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]perylen-3-amine.
| Compound Name | N,N-bis[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]perylen-3-amine |
|---|---|
| PubChem CID | 156580224 |
| Molecular Formula | C48H25F12N |
| Molecular Weight | 843.71 g/mol |
| Exact Mass | 843.18 |
| IUPAC Name | N,N-bis[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]perylen-3-amine |
| SMILES | FC(F)(F)c1cc(-c2ccc(N(c3ccc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)cc3)c3ccc4c5cccc6cccc(c7cccc3c74)c65)cc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C48H25F12N/c49-45(50,51)31-20-29(21-32(24-31)46(52,53)54)26-10-14-35(15-11-26)61(36-16-12-27(13-17-36)30-22-33(47(55,56)57)25-34(23-30)48(58,59)60)42-19-18-40-38-7-2-5-28-4-1-6-37(43(28)38)39-8-3-9-41(42)44(39)40/h1-25H |
| InChIKey | JIPNIARUROWJIW-UHFFFAOYSA-N |
| XLogP | 16.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.71 |
| LogP ≤ 5 | 16.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|