C11H15BrN2O — CID 156580290
5-bromo-4-(cyclopentylmethoxy)pyridin-2-amine (PubChem CID 156580290) has the molecular formula C11H15BrN2O and a molecular weight of 271.16 g/mol. Its IUPAC name is 5-bromo-4-(cyclopentylmethoxy)pyridin-2-amine.
| Compound Name | 5-bromo-4-(cyclopentylmethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 156580290 |
| Molecular Formula | C11H15BrN2O |
| Molecular Weight | 271.16 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 5-bromo-4-(cyclopentylmethoxy)pyridin-2-amine |
| SMILES | Nc1cc(OCC2CCCC2)c(Br)cn1 |
| InChI | InChI=1S/C11H15BrN2O/c12-9-6-14-11(13)5-10(9)15-7-8-3-1-2-4-8/h5-6,8H,1-4,7H2,(H2,13,14) |
| InChIKey | MMXAVOATXYYPRX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.16 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |