C15H22O4 — CID 156580345
(5R,5aR,6S,9aS)-5-hydroxy-6-(hydroxymethyl)-6,9a-dimethyl-4,5,5a,7,8,9-hexahydro-1H-benzo[e][2]benzofuran-3-one (PubChem CID 156580345) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (5R,5aR,6S,9aS)-5-hydroxy-6-(hydroxymethyl)-6,9a-dimethyl-4,5,5a,7,8,9-hexahydro-1H-benzo[e][2]benzofuran-3-one.
| Compound Name | (5R,5aR,6S,9aS)-5-hydroxy-6-(hydroxymethyl)-6,9a-dimethyl-4,5,5a,7,8,9-hexahydro-1H-benzo[e][2]benzofuran-3-one |
|---|---|
| PubChem CID | 156580345 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (5R,5aR,6S,9aS)-5-hydroxy-6-(hydroxymethyl)-6,9a-dimethyl-4,5,5a,7,8,9-hexahydro-1H-benzo[e][2]benzofuran-3-one |
| SMILES | C[C@]1(CO)CCC[C@]2(C)C3=C(C[C@@H](O)[C@@H]12)C(=O)OC3 |
| InChI | InChI=1S/C15H22O4/c1-14(8-16)4-3-5-15(2)10-7-19-13(18)9(10)6-11(17)12(14)15/h11-12,16-17H,3-8H2,1-2H3/t11-,12+,14-,15-/m1/s1 |
| InChIKey | BOJLRPXCHKKNCK-AYRXBEOTSA-N |
| XLogP | 1.41 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |