C22H28O7 — CID 156580371
6-[6-[(2R,3R,3aR,4R,5R,6aS)-2-ethyl-3,4-dihydroxy-3,3a-dimethyl-2,4,5,6a-tetrahydrofuro[2,3-b]furan-5-yl]hexa-1,3,5-trienyl]-4-methoxypyran-2-one (PubChem CID 156580371) has the molecular formula C22H28O7 and a molecular weight of 404.46 g/mol. Its IUPAC name is 6-[6-[(2R,3R,3aR,4R,5R,6aS)-2-ethyl-3,4-dihydroxy-3,3a-dimethyl-2,4,5,6a-tetrahydrofuro[2,3-b]furan-5-yl]hexa-1,3,5-trienyl]-4-methoxypyran-2-one.
| Compound Name | 6-[6-[(2R,3R,3aR,4R,5R,6aS)-2-ethyl-3,4-dihydroxy-3,3a-dimethyl-2,4,5,6a-tetrahydrofuro[2,3-b]furan-5-yl]hexa-1,3,5-trienyl]-4-methoxypyran-2-one |
|---|---|
| PubChem CID | 156580371 |
| Molecular Formula | C22H28O7 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 6-[6-[(2R,3R,3aR,4R,5R,6aS)-2-ethyl-3,4-dihydroxy-3,3a-dimethyl-2,4,5,6a-tetrahydrofuro[2,3-b]furan-5-yl]hexa-1,3,5-trienyl]-4-methoxypyran-2-one |
| SMILES | CC[C@H]1O[C@@H]2O[C@H](C=CC=CC=Cc3cc(OC)cc(=O)o3)[C@H](O)[C@]2(C)[C@@]1(C)O |
| InChI | InChI=1S/C22H28O7/c1-5-17-22(3,25)21(2)19(24)16(28-20(21)29-17)11-9-7-6-8-10-14-12-15(26-4)13-18(23)27-14/h6-13,16-17,19-20,24-25H,5H2,1-4H3/t16-,17-,19+,20+,21+,22+/m1/s1 |
| InChIKey | HITOGNCAEBBQJD-OLAQMGEPSA-N |
| XLogP | 2.43 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|