About 2-[(2S)-7-methylocta-3,5-dien-2-yl]-1,3-thiazole-4-carboxylic acid
2-[(2S)-7-methylocta-3,5-dien-2-yl]-1,3-thiazole-4-carboxylic acid (PubChem CID 156580373) has the molecular formula C13H17NO2S
and a molecular weight of 251.35 g/mol. Its IUPAC name is 2-[(2S)-7-methylocta-3,5-dien-2-yl]-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(2S)-7-methylocta-3,5-dien-2-yl]-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 156580373 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 2-[(2S)-7-methylocta-3,5-dien-2-yl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(C)C=CC=C[C@H](C)c1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C13H17NO2S/c1-9(2)6-4-5-7-10(3)12-14-11(8-17-12)13(15)16/h4-10H,1-3H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | MZDDJMJPPQGIRI-JTQLQIEISA-N |
| XLogP | 3.71 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2S)-7-methylocta-3,5-dien-2-yl]-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-7-methylocta-3,5-dien-2-yl]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-[(2S)-7-methylocta-3,5-dien-2-yl]-1,3-thiazole-4-carboxylic acid (CID 156580373) is 2-[(2S)-7-methylocta-3,5-dien-2-yl]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-[(2S)-7-methylocta-3,5-dien-2-yl]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-[(2S)-7-methylocta-3,5-dien-2-yl]-1,3-thiazole-4-carboxylic acid is CC(C)C=CC=C[C@H](C)c1nc(C(=O)O)cs1.
What is the InChIKey of 2-[(2S)-7-methylocta-3,5-dien-2-yl]-1,3-thiazole-4-carboxylic acid?
The InChIKey is MZDDJMJPPQGIRI-JTQLQIEISA-N. The full InChI is InChI=1S/C13H17NO2S/c1-9(2)6-4-5-7-10(3)12-14-11(8-17-12)13(15)16/h4-10H,1-3H3,(H,15,16)/t10-/m0/s1.
What are the key properties of 2-[(2S)-7-methylocta-3,5-dien-2-yl]-1,3-thiazole-4-carboxylic acid?
2-[(2S)-7-methylocta-3,5-dien-2-yl]-1,3-thiazole-4-carboxylic acid has a molecular weight of 251.35 g/mol, XLogP of 3.71, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-7-methylocta-3,5-dien-2-yl]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 156580373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).