C15H22O2 — CID 156580377
(1R,3S,5R,8R,11R)-3,11-dimethyl-6-methylidenetricyclo[6.3.0.01,5]undecane-3-carboxylic acid (PubChem CID 156580377) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (1R,3S,5R,8R,11R)-3,11-dimethyl-6-methylidenetricyclo[6.3.0.01,5]undecane-3-carboxylic acid.
| Compound Name | (1R,3S,5R,8R,11R)-3,11-dimethyl-6-methylidenetricyclo[6.3.0.01,5]undecane-3-carboxylic acid |
|---|---|
| PubChem CID | 156580377 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (1R,3S,5R,8R,11R)-3,11-dimethyl-6-methylidenetricyclo[6.3.0.01,5]undecane-3-carboxylic acid |
| SMILES | C=C1C[C@H]2CC[C@@H](C)[C@]23C[C@@](C)(C(=O)O)C[C@H]13 |
| InChI | InChI=1S/C15H22O2/c1-9-6-11-5-4-10(2)15(11)8-14(3,13(16)17)7-12(9)15/h10-12H,1,4-8H2,2-3H3,(H,16,17)/t10-,11-,12-,14+,15-/m1/s1 |
| InChIKey | JVNVDDIKCOCXJF-MYYUVRNCSA-N |
| XLogP | 3.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|