C15H20O4 — CID 156580469
(1R,3S,5S,8R,11R)-3,11-dimethyltricyclo[6.3.0.01,5]undec-6-ene-3,6-dicarboxylic acid (PubChem CID 156580469) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (1R,3S,5S,8R,11R)-3,11-dimethyltricyclo[6.3.0.01,5]undec-6-ene-3,6-dicarboxylic acid.
| Compound Name | (1R,3S,5S,8R,11R)-3,11-dimethyltricyclo[6.3.0.01,5]undec-6-ene-3,6-dicarboxylic acid |
|---|---|
| PubChem CID | 156580469 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (1R,3S,5S,8R,11R)-3,11-dimethyltricyclo[6.3.0.01,5]undec-6-ene-3,6-dicarboxylic acid |
| SMILES | C[C@@H]1CC[C@@H]2C=C(C(=O)O)[C@H]3C[C@](C)(C(=O)O)C[C@]132 |
| InChI | InChI=1S/C15H20O4/c1-8-3-4-9-5-10(12(16)17)11-6-14(2,13(18)19)7-15(8,9)11/h5,8-9,11H,3-4,6-7H2,1-2H3,(H,16,17)(H,18,19)/t8-,9-,11-,14+,15-/m1/s1 |
| InChIKey | HUJFKZCVAUJOMH-HVBVWTFJSA-N |
| XLogP | 2.54 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |