C32H54O8 — CID 156580534
(5R,12R)-12-ethyl-1-hydroxy-8,10-dimethyl-5-[(2R,3R,4R,8S,9R,10R,11S)-3,9,11-trihydroxy-4,6,8,10-tetramethyltridec-6-en-2-yl]-4,13-dioxabicyclo[8.2.1]tridec-7-ene-3,11-dione (PubChem CID 156580534) has the molecular formula C32H54O8 and a molecular weight of 566.78 g/mol. Its IUPAC name is (5R,12R)-12-ethyl-1-hydroxy-8,10-dimethyl-5-[(2R,3R,4R,8S,9R,10R,11S)-3,9,11-trihydroxy-4,6,8,10-tetramethyltridec-6-en-2-yl]-4,13-dioxabicyclo[8.2.1]tridec-7-ene-3,11-dione.
| Compound Name | (5R,12R)-12-ethyl-1-hydroxy-8,10-dimethyl-5-[(2R,3R,4R,8S,9R,10R,11S)-3,9,11-trihydroxy-4,6,8,10-tetramethyltridec-6-en-2-yl]-4,13-dioxabicyclo[8.2.1]tridec-7-ene-3,11-dione |
|---|---|
| PubChem CID | 156580534 |
| Molecular Formula | C32H54O8 |
| Molecular Weight | 566.78 g/mol |
| Exact Mass | 566.38 |
| IUPAC Name | (5R,12R)-12-ethyl-1-hydroxy-8,10-dimethyl-5-[(2R,3R,4R,8S,9R,10R,11S)-3,9,11-trihydroxy-4,6,8,10-tetramethyltridec-6-en-2-yl]-4,13-dioxabicyclo[8.2.1]tridec-7-ene-3,11-dione |
| SMILES | CC[C@@H]1C(=O)C2(C)CC(C)=CC[C@H]([C@H](C)[C@H](O)[C@H](C)CC(C)=C[C@H](C)[C@@H](O)[C@H](C)[C@@H](O)CC)OC(=O)CC1(O)O2 |
| InChI | InChI=1S/C32H54O8/c1-10-24-30(37)31(9)16-18(3)12-13-26(39-27(34)17-32(24,38)40-31)23(8)29(36)21(6)15-19(4)14-20(5)28(35)22(7)25(33)11-2/h12,14,20-26,28-29,33,35-36,38H,10-11,13,15-17H2,1-9H3/t20-,21+,22+,23-,24+,25-,26+,28+,29+,31?,32?/m0/s1 |
| InChIKey | GLIPEBQBWMVZJH-CPMPDNOVSA-N |
| XLogP | 4.47 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.78 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|