C20H38O7 — CID 156580583
(3R,5R)-3-[(3R,5R)-3,5-dihydroxydecanoyl]oxy-5-hydroxydecanoic acid (PubChem CID 156580583) has the molecular formula C20H38O7 and a molecular weight of 390.52 g/mol. Its IUPAC name is (3R,5R)-3-[(3R,5R)-3,5-dihydroxydecanoyl]oxy-5-hydroxydecanoic acid.
| Compound Name | (3R,5R)-3-[(3R,5R)-3,5-dihydroxydecanoyl]oxy-5-hydroxydecanoic acid |
|---|---|
| PubChem CID | 156580583 |
| Molecular Formula | C20H38O7 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | (3R,5R)-3-[(3R,5R)-3,5-dihydroxydecanoyl]oxy-5-hydroxydecanoic acid |
| SMILES | CCCCC[C@@H](O)C[C@@H](O)CC(=O)O[C@@H](CC(=O)O)C[C@H](O)CCCCC |
| InChI | InChI=1S/C20H38O7/c1-3-5-7-9-15(21)11-17(23)13-20(26)27-18(14-19(24)25)12-16(22)10-8-6-4-2/h15-18,21-23H,3-14H2,1-2H3,(H,24,25)/t15-,16-,17-,18-/m1/s1 |
| InChIKey | CTNBQIWYCDDZAM-BRSBDYLESA-N |
| XLogP | 2.79 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|