C24H29NO2 — CID 156580610
(3Z,5E,7Z,9Z,12R,13E,15E,17Z,19Z,21Z,23R)-12-hydroxy-23-methyl-1-azacyclotetracosa-3,5,7,9,13,15,17,19,21-nonaen-2-one (PubChem CID 156580610) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is (3Z,5E,7Z,9Z,12R,13E,15E,17Z,19Z,21Z,23R)-12-hydroxy-23-methyl-1-azacyclotetracosa-3,5,7,9,13,15,17,19,21-nonaen-2-one.
| Compound Name | (3Z,5E,7Z,9Z,12R,13E,15E,17Z,19Z,21Z,23R)-12-hydroxy-23-methyl-1-azacyclotetracosa-3,5,7,9,13,15,17,19,21-nonaen-2-one |
|---|---|
| PubChem CID | 156580610 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (3Z,5E,7Z,9Z,12R,13E,15E,17Z,19Z,21Z,23R)-12-hydroxy-23-methyl-1-azacyclotetracosa-3,5,7,9,13,15,17,19,21-nonaen-2-one |
| SMILES | C[C@@H]1/C=C\C=C/C=C/C=C/C=C/[C@H](O)C/C=C\C=C/C=C/C=C\C(=O)NC1 |
| InChI | InChI=1S/C24H29NO2/c1-22-17-13-9-5-2-3-6-10-14-18-23(26)19-15-11-7-4-8-12-16-20-24(27)25-21-22/h2-18,20,22-23,26H,19,21H2,1H3,(H,25,27)/b3-2+,7-4-,9-5-,10-6+,12-8+,15-11-,17-13-,18-14+,20-16-/t22-,23+/m1/s1 |
| InChIKey | KPEMWDNFHKXYQE-OXPNWPCBSA-N |
| XLogP | 4.51 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |