C17H22O4 — CID 156580612
(1S,3S,11S)-3-[(2S)-butan-2-yl]-7-hydroxy-6,11-dimethyl-2,12-dioxatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-4-one (PubChem CID 156580612) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is (1S,3S,11S)-3-[(2S)-butan-2-yl]-7-hydroxy-6,11-dimethyl-2,12-dioxatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-4-one.
| Compound Name | (1S,3S,11S)-3-[(2S)-butan-2-yl]-7-hydroxy-6,11-dimethyl-2,12-dioxatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-4-one |
|---|---|
| PubChem CID | 156580612 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (1S,3S,11S)-3-[(2S)-butan-2-yl]-7-hydroxy-6,11-dimethyl-2,12-dioxatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-4-one |
| SMILES | CC[C@H](C)[C@@H]1O[C@@H]2O[C@@H](C)Cc3cc(O)c(C)c(c32)C1=O |
| InChI | InChI=1S/C17H22O4/c1-5-8(2)16-15(19)13-10(4)12(18)7-11-6-9(3)20-17(21-16)14(11)13/h7-9,16-18H,5-6H2,1-4H3/t8-,9-,16-,17-/m0/s1 |
| InChIKey | JUYMRCCNIQTZTJ-XLMPQJIHSA-N |
| XLogP | 3.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |