C18H24O3 — CID 156580692
(1S,2R,5R,7S,10S,11S,12R,15S)-1,5,12-trimethyl-13-oxatetracyclo[8.6.0.02,7.011,15]hexadec-8-ene-14,16-dione (PubChem CID 156580692) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is (1S,2R,5R,7S,10S,11S,12R,15S)-1,5,12-trimethyl-13-oxatetracyclo[8.6.0.02,7.011,15]hexadec-8-ene-14,16-dione.
| Compound Name | (1S,2R,5R,7S,10S,11S,12R,15S)-1,5,12-trimethyl-13-oxatetracyclo[8.6.0.02,7.011,15]hexadec-8-ene-14,16-dione |
|---|---|
| PubChem CID | 156580692 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (1S,2R,5R,7S,10S,11S,12R,15S)-1,5,12-trimethyl-13-oxatetracyclo[8.6.0.02,7.011,15]hexadec-8-ene-14,16-dione |
| SMILES | C[C@@H]1CC[C@@H]2[C@H](C=C[C@H]3[C@H]4[C@H](C(=O)O[C@@H]4C)C(=O)[C@@]23C)C1 |
| InChI | InChI=1S/C18H24O3/c1-9-4-6-12-11(8-9)5-7-13-14-10(2)21-17(20)15(14)16(19)18(12,13)3/h5,7,9-15H,4,6,8H2,1-3H3/t9-,10-,11-,12-,13+,14+,15+,18+/m1/s1 |
| InChIKey | PFAHGEMYIFOKEX-RDXNZHOWSA-N |
| XLogP | 2.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|