C15H24O4 — CID 156580711
(1R,4S,4aR,6S,7aS,7bR)-3,6-bis(hydroxymethyl)-6,7b-dimethyl-2,4,4a,5,7,7a-hexahydro-1H-cyclobuta[e]indene-1,4-diol (PubChem CID 156580711) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (1R,4S,4aR,6S,7aS,7bR)-3,6-bis(hydroxymethyl)-6,7b-dimethyl-2,4,4a,5,7,7a-hexahydro-1H-cyclobuta[e]indene-1,4-diol.
| Compound Name | (1R,4S,4aR,6S,7aS,7bR)-3,6-bis(hydroxymethyl)-6,7b-dimethyl-2,4,4a,5,7,7a-hexahydro-1H-cyclobuta[e]indene-1,4-diol |
|---|---|
| PubChem CID | 156580711 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (1R,4S,4aR,6S,7aS,7bR)-3,6-bis(hydroxymethyl)-6,7b-dimethyl-2,4,4a,5,7,7a-hexahydro-1H-cyclobuta[e]indene-1,4-diol |
| SMILES | C[C@@]1(CO)C[C@H]2[C@H](O)C(CO)=C3C[C@@H](O)[C@]3(C)[C@H]2C1 |
| InChI | InChI=1S/C15H24O4/c1-14(7-17)4-8-11(5-14)15(2)10(3-12(15)18)9(6-16)13(8)19/h8,11-13,16-19H,3-7H2,1-2H3/t8-,11+,12-,13+,14-,15+/m1/s1 |
| InChIKey | JOVICQUEDPZUGK-KFBSQEHXSA-N |
| XLogP | 0.45 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|