C9H12O4 — CID 156580716
(3S,3aR,7aS)-4-methoxy-3-methyl-2,3,3a,7a-tetrahydrofuro[2,3-b]pyran-6-one (PubChem CID 156580716) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is (3S,3aR,7aS)-4-methoxy-3-methyl-2,3,3a,7a-tetrahydrofuro[2,3-b]pyran-6-one.
| Compound Name | (3S,3aR,7aS)-4-methoxy-3-methyl-2,3,3a,7a-tetrahydrofuro[2,3-b]pyran-6-one |
|---|---|
| PubChem CID | 156580716 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (3S,3aR,7aS)-4-methoxy-3-methyl-2,3,3a,7a-tetrahydrofuro[2,3-b]pyran-6-one |
| SMILES | COC1=CC(=O)O[C@@H]2OC[C@@H](C)[C@H]12 |
| InChI | InChI=1S/C9H12O4/c1-5-4-12-9-8(5)6(11-2)3-7(10)13-9/h3,5,8-9H,4H2,1-2H3/t5-,8-,9+/m1/s1 |
| InChIKey | AEXYLHORBRACLC-CGMLFGJQSA-N |
| XLogP | 0.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |