C12H22O2 — CID 156580773
(1S,3S,4aR,5S,8aR)-5,8a-dimethyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene-1,3-diol (PubChem CID 156580773) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (1S,3S,4aR,5S,8aR)-5,8a-dimethyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene-1,3-diol.
| Compound Name | (1S,3S,4aR,5S,8aR)-5,8a-dimethyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene-1,3-diol |
|---|---|
| PubChem CID | 156580773 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (1S,3S,4aR,5S,8aR)-5,8a-dimethyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene-1,3-diol |
| SMILES | C[C@H]1CCC[C@]2(C)[C@@H]1C[C@H](O)C[C@@H]2O |
| InChI | InChI=1S/C12H22O2/c1-8-4-3-5-12(2)10(8)6-9(13)7-11(12)14/h8-11,13-14H,3-7H2,1-2H3/t8-,9-,10+,11-,12+/m0/s1 |
| InChIKey | LRMMAMMVADDDHZ-HHHUOAJASA-N |
| XLogP | 1.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |