C29H26O9 — CID 156580810
(1R,21S,22S,24S)-3,18,22,24-tetrahydroxy-7,14,19-trimethoxy-22,24-dimethylheptacyclo[19.2.1.01,10.04,9.08,13.011,20.012,17]tetracosa-3,6,8(13),9,11(20),12(17),14,18-octaene-5,16-dione (PubChem CID 156580810) has the molecular formula C29H26O9 and a molecular weight of 518.52 g/mol. Its IUPAC name is (1R,21S,22S,24S)-3,18,22,24-tetrahydroxy-7,14,19-trimethoxy-22,24-dimethylheptacyclo[19.2.1.01,10.04,9.08,13.011,20.012,17]tetracosa-3,6,8(13),9,11(20),12(17),14,18-octaene-5,16-dione.
| Compound Name | (1R,21S,22S,24S)-3,18,22,24-tetrahydroxy-7,14,19-trimethoxy-22,24-dimethylheptacyclo[19.2.1.01,10.04,9.08,13.011,20.012,17]tetracosa-3,6,8(13),9,11(20),12(17),14,18-octaene-5,16-dione |
|---|---|
| PubChem CID | 156580810 |
| Molecular Formula | C29H26O9 |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | (1R,21S,22S,24S)-3,18,22,24-tetrahydroxy-7,14,19-trimethoxy-22,24-dimethylheptacyclo[19.2.1.01,10.04,9.08,13.011,20.012,17]tetracosa-3,6,8(13),9,11(20),12(17),14,18-octaene-5,16-dione |
| SMILES | COc1c2c3c4c5c(c(=O)cc(OC)c5c5c(OC)cc(=O)c(c1O)c35)=C(O)C[C@]41C[C@](C)(O)[C@H]2[C@]1(C)O |
| InChI | InChI=1S/C29H26O9/c1-27(34)9-29-8-12(32)15-10(30)6-14(37-4)18-17-13(36-3)7-11(31)16-19(17)21(23(29)20(15)18)22(25(38-5)24(16)33)26(27)28(29,2)35/h6-7,26,32-35H,8-9H2,1-5H3/t26-,27-,28-,29-/m0/s1 |
| InChIKey | OPQIHJUOAUBODM-DZUOILHNSA-N |
| XLogP | 2.07 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|