C28H29NO5S — CID 156580825
9-[(2R,5S,6S)-5-(dimethylamino)-6-methyloxan-2-yl]-1,8-dihydroxy-3-methyl-5-methylsulfanylbenzo[a]anthracene-7,12-dione (PubChem CID 156580825) has the molecular formula C28H29NO5S and a molecular weight of 491.61 g/mol. Its IUPAC name is 9-[(2R,5S,6S)-5-(dimethylamino)-6-methyloxan-2-yl]-1,8-dihydroxy-3-methyl-5-methylsulfanylbenzo[a]anthracene-7,12-dione.
| Compound Name | 9-[(2R,5S,6S)-5-(dimethylamino)-6-methyloxan-2-yl]-1,8-dihydroxy-3-methyl-5-methylsulfanylbenzo[a]anthracene-7,12-dione |
|---|---|
| PubChem CID | 156580825 |
| Molecular Formula | C28H29NO5S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 9-[(2R,5S,6S)-5-(dimethylamino)-6-methyloxan-2-yl]-1,8-dihydroxy-3-methyl-5-methylsulfanylbenzo[a]anthracene-7,12-dione |
| SMILES | CSc1cc2c(c3c(O)cc(C)cc13)C(=O)c1ccc([C@H]3CC[C@H](N(C)C)[C@H](C)O3)c(O)c1C2=O |
| InChI | InChI=1S/C28H29NO5S/c1-13-10-17-22(35-5)12-18-24(23(17)20(30)11-13)27(32)16-7-6-15(26(31)25(16)28(18)33)21-9-8-19(29(3)4)14(2)34-21/h6-7,10-12,14,19,21,30-31H,8-9H2,1-5H3/t14-,19-,21+/m0/s1 |
| InChIKey | GAURKSMOZWNCBH-ONTRVFCTSA-N |
| XLogP | 5.23 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'keto_naphthol_A(2)', 'substructure': 'N/A'} |
|---|