C15H26O3 — CID 156580842
(2S,3aE,6R,9R,9aR)-2,4-bis(hydroxymethyl)-2,9-dimethyl-1,3,5,6,7,8,9,9a-octahydrocyclopenta[8]annulen-6-ol (PubChem CID 156580842) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (2S,3aE,6R,9R,9aR)-2,4-bis(hydroxymethyl)-2,9-dimethyl-1,3,5,6,7,8,9,9a-octahydrocyclopenta[8]annulen-6-ol.
| Compound Name | (2S,3aE,6R,9R,9aR)-2,4-bis(hydroxymethyl)-2,9-dimethyl-1,3,5,6,7,8,9,9a-octahydrocyclopenta[8]annulen-6-ol |
|---|---|
| PubChem CID | 156580842 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (2S,3aE,6R,9R,9aR)-2,4-bis(hydroxymethyl)-2,9-dimethyl-1,3,5,6,7,8,9,9a-octahydrocyclopenta[8]annulen-6-ol |
| SMILES | C[C@@H]1CC[C@@H](O)C/C(CO)=C2/C[C@@](C)(CO)C[C@@H]21 |
| InChI | InChI=1S/C15H26O3/c1-10-3-4-12(18)5-11(8-16)14-7-15(2,9-17)6-13(10)14/h10,12-13,16-18H,3-9H2,1-2H3/b14-11+/t10-,12-,13-,15+/m1/s1 |
| InChIKey | QPDXUDPCDAPTSD-BKHLEUHSSA-N |
| XLogP | 1.86 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|