C14H18O4 — CID 156580844
(5S,5aS,7S,8aR)-7-(hydroxymethyl)-5,7-dimethyl-1,5,5a,6,8,8a-hexahydrocyclopenta[e][2]benzofuran-3,4-dione (PubChem CID 156580844) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is (5S,5aS,7S,8aR)-7-(hydroxymethyl)-5,7-dimethyl-1,5,5a,6,8,8a-hexahydrocyclopenta[e][2]benzofuran-3,4-dione.
| Compound Name | (5S,5aS,7S,8aR)-7-(hydroxymethyl)-5,7-dimethyl-1,5,5a,6,8,8a-hexahydrocyclopenta[e][2]benzofuran-3,4-dione |
|---|---|
| PubChem CID | 156580844 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (5S,5aS,7S,8aR)-7-(hydroxymethyl)-5,7-dimethyl-1,5,5a,6,8,8a-hexahydrocyclopenta[e][2]benzofuran-3,4-dione |
| SMILES | C[C@@H]1C(=O)C2=C(COC2=O)[C@@H]2C[C@@](C)(CO)C[C@H]12 |
| InChI | InChI=1S/C14H18O4/c1-7-8-3-14(2,6-15)4-9(8)10-5-18-13(17)11(10)12(7)16/h7-9,15H,3-6H2,1-2H3/t7-,8+,9+,14-/m0/s1 |
| InChIKey | JCQXXTVVCKLVHP-HZFYHNGZSA-N |
| XLogP | 1.08 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|