C16H22O5 — CID 156581011
methyl (5R)-5-[(1E,3E,5R)-5-hydroxyhexa-1,3-dienyl]-5-methyl-4-oxo-2-propylfuran-3-carboxylate (PubChem CID 156581011) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is methyl (5R)-5-[(1E,3E,5R)-5-hydroxyhexa-1,3-dienyl]-5-methyl-4-oxo-2-propylfuran-3-carboxylate.
| Compound Name | methyl (5R)-5-[(1E,3E,5R)-5-hydroxyhexa-1,3-dienyl]-5-methyl-4-oxo-2-propylfuran-3-carboxylate |
|---|---|
| PubChem CID | 156581011 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | methyl (5R)-5-[(1E,3E,5R)-5-hydroxyhexa-1,3-dienyl]-5-methyl-4-oxo-2-propylfuran-3-carboxylate |
| SMILES | CCCC1=C(C(=O)OC)C(=O)[C@@](C)(/C=C/C=C/[C@@H](C)O)O1 |
| InChI | InChI=1S/C16H22O5/c1-5-8-12-13(15(19)20-4)14(18)16(3,21-12)10-7-6-9-11(2)17/h6-7,9-11,17H,5,8H2,1-4H3/b9-6+,10-7+/t11-,16-/m1/s1 |
| InChIKey | OLFTVRVPEUFOCA-NKQBZVLWSA-N |
| XLogP | 2.06 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|