C15H16O5 — CID 156581085
(1R,9R,12S,14R)-6-hydroxy-4-methoxy-12-methyl-11,15-dioxatetracyclo[10.2.1.02,7.09,14]pentadeca-2(7),3,5-trien-8-one (PubChem CID 156581085) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is (1R,9R,12S,14R)-6-hydroxy-4-methoxy-12-methyl-11,15-dioxatetracyclo[10.2.1.02,7.09,14]pentadeca-2(7),3,5-trien-8-one.
| Compound Name | (1R,9R,12S,14R)-6-hydroxy-4-methoxy-12-methyl-11,15-dioxatetracyclo[10.2.1.02,7.09,14]pentadeca-2(7),3,5-trien-8-one |
|---|---|
| PubChem CID | 156581085 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (1R,9R,12S,14R)-6-hydroxy-4-methoxy-12-methyl-11,15-dioxatetracyclo[10.2.1.02,7.09,14]pentadeca-2(7),3,5-trien-8-one |
| SMILES | COc1cc(O)c2c(c1)[C@@H]1O[C@@]3(C)C[C@@H]1[C@H](CO3)C2=O |
| InChI | InChI=1S/C15H16O5/c1-15-5-9-10(6-19-15)13(17)12-8(14(9)20-15)3-7(18-2)4-11(12)16/h3-4,9-10,14,16H,5-6H2,1-2H3/t9-,10+,14+,15+/m1/s1 |
| InChIKey | JMEVZOTUJQHGDZ-QPNXVFALSA-N |
| XLogP | 2.04 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |