C15H26O3 — CID 156581089
(3aR,5S,7S,8R,8aS)-5-(hydroxymethyl)-2,2,8-trimethyl-4-methylidene-3,5,6,7,8,8a-hexahydro-1H-azulene-3a,7-diol (PubChem CID 156581089) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (3aR,5S,7S,8R,8aS)-5-(hydroxymethyl)-2,2,8-trimethyl-4-methylidene-3,5,6,7,8,8a-hexahydro-1H-azulene-3a,7-diol.
| Compound Name | (3aR,5S,7S,8R,8aS)-5-(hydroxymethyl)-2,2,8-trimethyl-4-methylidene-3,5,6,7,8,8a-hexahydro-1H-azulene-3a,7-diol |
|---|---|
| PubChem CID | 156581089 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (3aR,5S,7S,8R,8aS)-5-(hydroxymethyl)-2,2,8-trimethyl-4-methylidene-3,5,6,7,8,8a-hexahydro-1H-azulene-3a,7-diol |
| SMILES | C=C1[C@@H](CO)C[C@H](O)[C@H](C)[C@@H]2CC(C)(C)C[C@]12O |
| InChI | InChI=1S/C15H26O3/c1-9-12-6-14(3,4)8-15(12,18)10(2)11(7-16)5-13(9)17/h9,11-13,16-18H,2,5-8H2,1,3-4H3/t9-,11-,12+,13+,15+/m1/s1 |
| InChIKey | OPQZTUAVUGSQFW-PYISLEMLSA-N |
| XLogP | 1.72 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|