C11H16O3 — CID 156581153
3-hexyl-4-methylideneoxolane-2,5-dione (PubChem CID 156581153) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-hexyl-4-methylideneoxolane-2,5-dione.
| Compound Name | 3-hexyl-4-methylideneoxolane-2,5-dione |
|---|---|
| PubChem CID | 156581153 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 3-hexyl-4-methylideneoxolane-2,5-dione |
| SMILES | C=C1C(=O)OC(=O)C1CCCCCC |
| InChI | InChI=1S/C11H16O3/c1-3-4-5-6-7-9-8(2)10(12)14-11(9)13/h9H,2-7H2,1H3 |
| InChIKey | RQHWISSQTBJTCQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|