C55H66N10O15S2 — CID 156581167
Retimycin A (PubChem CID 156581167) has the molecular formula C55H66N10O15S2 and a molecular weight of 1171.32 g/mol.
| Compound Name | Retimycin A |
|---|---|
| PubChem CID | 156581167 |
| Molecular Formula | C55H66N10O15S2 |
| Molecular Weight | 1171.32 g/mol |
| Exact Mass | 1170.42 |
| IUPAC Name | — |
| SMILES | CC1NC(=O)[C@H](NC(=O)c2nc3ccccc3cc2O)[C@@H](C)OC(=O)C2(CC2C)N(C)C(=O)C2C(S(C)=O)SCC(C(=O)N(C)C3(CC3C)C(=O)O[C@H](C)[C@@H](NC(=O)c3nc4ccccc4cc3O)C(=O)NC(C)C(=O)N2C)N(C)C1=O |
| InChI | InChI=1S/C55H66N10O15S2/c1-25-22-54(25)52(76)79-29(5)39(61-46(71)41-37(67)21-32-17-13-15-19-34(32)59-41)44(69)57-28(4)48(73)63(8)42-50(75)65(10)55(23-26(55)2)53(77)80-30(6)38(60-45(70)40-36(66)20-31-16-12-14-18-33(31)58-40)43(68)56-27(3)47(72)62(7)35(49(74)64(54)9)24-81-51(42)82(11)78/h12-21,25-30,35,38-39,42,51,66-67H,22-24H2,1-11H3,(H,56,68)(H,57,69)(H,60,70)(H,61,71)/t25?,26?,27?,28?,29-,30-,35?,38-,39-,42?,51?,54?,55?,82?/m1/s1 |
| InChIKey | KDRVEKPMWVHCOU-QVOODLETSA-N |
| XLogP | 0.56 |
| TPSA | 333.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1171.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |