C20H33NO — CID 156581199
(Z,2S,3R)-2-amino-1-phenyltetradec-9-en-3-ol (PubChem CID 156581199) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is (Z,2S,3R)-2-amino-1-phenyltetradec-9-en-3-ol.
| Compound Name | (Z,2S,3R)-2-amino-1-phenyltetradec-9-en-3-ol |
|---|---|
| PubChem CID | 156581199 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | (Z,2S,3R)-2-amino-1-phenyltetradec-9-en-3-ol |
| SMILES | CCCC/C=C\CCCCC[C@@H](O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C20H33NO/c1-2-3-4-5-6-7-8-9-13-16-20(22)19(21)17-18-14-11-10-12-15-18/h5-6,10-12,14-15,19-20,22H,2-4,7-9,13,16-17,21H2,1H3/b6-5-/t19-,20+/m0/s1 |
| InChIKey | FKPYLTODMCREPA-DXPXIUTNSA-N |
| XLogP | 4.61 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|